4-[9-(4-hydroxy-3,5-dimethyl-phenyl)fluoren-9-yl]-2,6-dimethyl-phenol structure
|
Common Name | 4-[9-(4-hydroxy-3,5-dimethyl-phenyl)fluoren-9-yl]-2,6-dimethyl-phenol | ||
|---|---|---|---|---|
| CAS Number | 80850-00-6 | Molecular Weight | 406.51600 | |
| Density | 1.205g/cm3 | Boiling Point | 541.8ºC at 760 mmHg | |
| Molecular Formula | C29H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.6ºC | |
| Name | 4-[9-(4-hydroxy-3,5-dimethylphenyl)fluoren-9-yl]-2,6-dimethylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.205g/cm3 |
|---|---|
| Boiling Point | 541.8ºC at 760 mmHg |
| Molecular Formula | C29H26O2 |
| Molecular Weight | 406.51600 |
| Flash Point | 235.6ºC |
| Exact Mass | 406.19300 |
| PSA | 40.46000 |
| LogP | 6.69450 |
| Index of Refraction | 1.668 |
| InChIKey | SNPPMOSOWNHABX-UHFFFAOYSA-N |
| SMILES | Cc1cc(C2(c3cc(C)c(O)c(C)c3)c3ccccc3-c3ccccc32)cc(C)c1O |
|
~87%
4-[9-(4-hydroxy... CAS#:80850-00-6 |
| Literature: TAOKA CHEMICAL CO., LTD. Patent: US2012/29244 A1, 2012 ; Location in patent: Page/Page column 14-15 ; |
|
~69%
4-[9-(4-hydroxy... CAS#:80850-00-6 |
| Literature: Koutek, Bohumir; Musil, Lubomir; Velek, Jiri; Lycka, Antonin; Snobl, Dobroslav; et al. Collection of Czechoslovak Chemical Communications, 1981 , vol. 46, # 10 p. 2540 - 2556 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 9,9-bis(4-hydroxy-3,5-dimethylphenyl)fluorene |
| 9,9-[Bis(3,5-dimethyl-4-hydroxyphenyl)]fluorene |