Alitame structure
|
Common Name | Alitame | ||
|---|---|---|---|---|
| CAS Number | 80863-62-3 | Molecular Weight | 331.43 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 608.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C14H25N3O4S | Melting Point | 136-147° | |
| MSDS | N/A | Flash Point | 321.8±31.5 °C | |
Use of AlitameAlitame (anhydrous) is a high-intensity sweetener formed from the amino acids L-aspartic acid and D-alanine, and an amine derived from thietane[1]. |
| Name | (3S)-3-amino-4-oxo-4-[[(2R)-1-oxo-1-[(2,2,4,4-tetramethylthietan-3-yl)amino]propan-2-yl]amino]butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Alitame (anhydrous) is a high-intensity sweetener formed from the amino acids L-aspartic acid and D-alanine, and an amine derived from thietane[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 608.5±55.0 °C at 760 mmHg |
| Melting Point | 136-147° |
| Molecular Formula | C14H25N3O4S |
| Molecular Weight | 331.43 |
| Flash Point | 321.8±31.5 °C |
| Exact Mass | 331.156586 |
| PSA | 146.82000 |
| LogP | 1.17 |
| Vapour Pressure | 0.0±3.8 mmHg at 25°C |
| Index of Refraction | 1.560 |
| InChIKey | IVBOUFAWPCPFTQ-SFYZADRCSA-N |
| SMILES | CC(NC(=O)C(N)CC(=O)O)C(=O)NC1C(C)(C)SC1(C)C |
| HS Code | 2934999090 |
|---|
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(L-Aspartyl-D-alaninamido)-2,2,4,4-tetramethylthietane |
| (S)-3-Amino-4-oxo-4-(((R)-1-oxo-1-((2,2,4,4-tetramethylthietan-3-yl)amino)propan-2-yl)amino)butanoic acid |
| D-Alaninamide, L-α-aspartyl-N-(2,2,4,4-tetramethyl-3-thietanyl)- |
| L-aspartyl-D-alanine 2,2,4,4-tetramethylthietanylamide |
| L-α-Aspartyl-N-(2,2,4,4-tetramethylthietan-3-yl)-D-alaninamide |
| L-a-Aspartyl-N-(2,2,4,4-tetramethyl-3-thietanyl)-D-alaninamide |
| UNII-PCE8DAE750 |
| L-Aspartyl-D-alanine-N-(2,2,4,4-tetramethylthietan-3-yl)amide |
| L-α-Aspartyl-N-(2,2,4,4-tetramethyl-3-thietanyl)-D-alaninamide |
| Alitame |
| Aclame |