2,6-dichloro-4-mesylaniline structure
|
Common Name | 2,6-dichloro-4-mesylaniline | ||
|---|---|---|---|---|
| CAS Number | 80866-96-2 | Molecular Weight | 240.10700 | |
| Density | 1.525g/cm3 | Boiling Point | 414.7ºC at 760 mmHg | |
| Molecular Formula | C7H7Cl2NO2S | Melting Point | 155-158ºC | |
| MSDS | USA | Flash Point | 204.6ºC | |
| Name | 2,6-dichloro-4-methylsulfonylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.525g/cm3 |
|---|---|
| Boiling Point | 414.7ºC at 760 mmHg |
| Melting Point | 155-158ºC |
| Molecular Formula | C7H7Cl2NO2S |
| Molecular Weight | 240.10700 |
| Flash Point | 204.6ºC |
| Exact Mass | 238.95700 |
| PSA | 68.54000 |
| LogP | 3.64110 |
| Index of Refraction | 1.594 |
| InChIKey | JMVVMLXAGZVYMB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1cc(Cl)c(N)c(Cl)c1 |
| HS Code | 2921420090 |
|---|
|
~%
2,6-dichloro-4-... CAS#:80866-96-2 |
| Literature: Collection of Czechoslovak Chemical Communications, , vol. 33, p. 3988 - 3999 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,6-Dichlor-4-methylsulfonyl-anilin |
| 2,6-dichloro-4-mesylaniline |
| 2,6-Dichloro-4-(methylsulfonyl)aniline |
| 2,5-DIBROMO THIOZOLE > |
| 2,6-dichloro-4-(methylsulphonyl)aniline |
| 2,6-dichloro-4-methanesulphonylaniline |