2,6-Dichloro-4-methyl-3-nitropyridine structure
|
Common Name | 2,6-Dichloro-4-methyl-3-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 60010-03-9 | Molecular Weight | 207.014 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 316.9±37.0 °C at 760 mmHg | |
| Molecular Formula | C6H4Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.5±26.5 °C | |
| Name | 2,6-Dichloro-4-methyl-3-nitropyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 316.9±37.0 °C at 760 mmHg |
| Molecular Formula | C6H4Cl2N2O2 |
| Molecular Weight | 207.014 |
| Flash Point | 145.5±26.5 °C |
| Exact Mass | 205.964981 |
| PSA | 58.71000 |
| LogP | 2.23 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | CMJNIYUZFQWYCK-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)nc(Cl)c1[N+](=O)[O-] |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
|
~%
2,6-Dichloro-4-... CAS#:60010-03-9 |
| Literature: WO2010/122064 A1, ; Page/Page column 27 ; WO 2010/122064 A1 |
|
~%
2,6-Dichloro-4-... CAS#:60010-03-9 |
| Literature: WO2011/26890 A1, ; WO 2011/026890 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,6-Dichloro-4-methyl-3-nitropyridine |
| Pyridine, 2,6-dichloro-4-methyl-3-nitro- |
| 2,6-dichloro-4-methyl-3-nitro-pyridine |
| 2,5-DIBROMO-3-METHYLTHIOPHENE |