(E)-4-(3,4-dichlorophenyl)-4-oxo-but-2-enoic acid structure
|
Common Name | (E)-4-(3,4-dichlorophenyl)-4-oxo-but-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 80937-20-8 | Molecular Weight | 245.05900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H6Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (E)-4-(3,4-dichlorophenyl)-4-oxobut-2-enoic acid |
|---|
| Molecular Formula | C10H6Cl2O3 |
|---|---|
| Molecular Weight | 245.05900 |
| Exact Mass | 243.96900 |
| PSA | 54.37000 |
| LogP | 2.81690 |
| InChIKey | XIZWELOARFUPLO-ONEGZZNKSA-N |
| SMILES | O=C(O)C=CC(=O)c1ccc(Cl)c(Cl)c1 |
| HS Code | 2918300090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |