(E)-4-(4-acetamidophenyl)-4-oxo-but-2-enoic acid structure
|
Common Name | (E)-4-(4-acetamidophenyl)-4-oxo-but-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 24849-50-1 | Molecular Weight | 233.22000 | |
| Density | 1.33g/cm3 | Boiling Point | 517ºC at 760 mmHg | |
| Molecular Formula | C12H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.5ºC | |
| Name | (E)-4-(4-acetamidophenyl)-4-oxobut-2-enoic acid |
|---|
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 517ºC at 760 mmHg |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22000 |
| Flash Point | 266.5ºC |
| Exact Mass | 233.06900 |
| PSA | 83.47000 |
| LogP | 1.54150 |
| Vapour Pressure | 1.63E-11mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | WKBBETOKHYKFLI-VOTSOKGWSA-N |
| SMILES | CC(=O)Nc1ccc(C(=O)C=CC(=O)O)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
(E)-4-(4-acetam... CAS#:24849-50-1 |
| Literature: El-Hashash; Rizk; Aburzeza Egyptian Journal of Chemistry, 2011 , vol. 54, # 3 p. 299 - 312 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |