1-[4-(TRIFLUOROMETHYL)PHENYL]BUT-1-EN-3-ONE structure
|
Common Name | 1-[4-(TRIFLUOROMETHYL)PHENYL]BUT-1-EN-3-ONE | ||
|---|---|---|---|---|
| CAS Number | 80992-93-4 | Molecular Weight | 214.18400 | |
| Density | 1.206g/cm3 | Boiling Point | 118ºC | |
| Molecular Formula | C11H9F3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 119.7ºC | |
| Name | (Z)-4-(4-(Trifluoromethyl)phenyl)but-3-en-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.206g/cm3 |
|---|---|
| Boiling Point | 118ºC |
| Molecular Formula | C11H9F3O |
| Molecular Weight | 214.18400 |
| Flash Point | 119.7ºC |
| Exact Mass | 214.06100 |
| PSA | 17.07000 |
| LogP | 3.30760 |
| Index of Refraction | 1.495 |
| InChIKey | PHVQEHOBDSECPV-NSCUHMNNSA-N |
| SMILES | CC(=O)C=Cc1ccc(C(F)(F)F)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2914700090 |
|
~59%
1-[4-(TRIFLUORO... CAS#:80992-93-4 |
| Literature: Rajakumar; Rao Pharmazie, 1994 , vol. 49, # 7 p. 516 - 519 |
|
~%
1-[4-(TRIFLUORO... CAS#:80992-93-4 |
| Literature: Tetrahedron Letters, , vol. 54, # 6 p. 459 - 461 |
|
~%
1-[4-(TRIFLUORO... CAS#:80992-93-4 |
| Literature: Tetrahedron Letters, , vol. 54, # 6 p. 459 - 461 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| Z)-4(4-Trifluoromethylphenyl)-but-3-en-2-one |
| 1-[4-(Trifluoromethyl)phenyl]-1-buten-3-one |
| 4-[4-(Trifluoromethyl)phenyl]-3-buten-2-one |
| 4-[4-(trifluoromethyl)phenyl]but-3-en-2-one |
| (3Z)-4-[4-(Trifluoromethyl)phenyl]-3-buten-2-one |
| 4-trifluoromethylbenzylidene-acetone |
| p-Trifluoromethylbenzalacetone |
| 1-[4-(TRIFLUOROMETHYL)PHENYL]BUT-1-EN-3-ONE |
| 4-trifluoromethylbenzalacetone |