Benzamide,N-(4-chloro-9,10-dihydro-9,10-dioxo-1-anthracenyl) structure
|
Common Name | Benzamide,N-(4-chloro-9,10-dihydro-9,10-dioxo-1-anthracenyl) | ||
|---|---|---|---|---|
| CAS Number | 81-45-8 | Molecular Weight | 361.77800 | |
| Density | 1.447g/cm3 | Boiling Point | 506.2ºC at 760 mmHg | |
| Molecular Formula | C21H12ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260ºC | |
| Name | N-(4-chloro-9,10-dioxoanthracen-1-yl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.447g/cm3 |
|---|---|
| Boiling Point | 506.2ºC at 760 mmHg |
| Molecular Formula | C21H12ClNO3 |
| Molecular Weight | 361.77800 |
| Flash Point | 260ºC |
| Exact Mass | 361.05100 |
| PSA | 63.24000 |
| LogP | 4.44070 |
| Index of Refraction | 1.714 |
| InChIKey | FNCVZYRPXOZNSM-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Cl)c2c1C(=O)c1ccccc1C2=O)c1ccccc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
|
~%
Benzamide,N-(4-... CAS#:81-45-8 |
| Literature: Du Pont de Nemours and Co. Patent: US1963069 , 1931 ; Full Text Show Details Du Pont de Nemours and Co. Patent: US1963109 , 1929 ; |
|
~%
Benzamide,N-(4-... CAS#:81-45-8 |
| Literature: Mosgowa Zhurnal Obshchei Khimii, 1949 , vol. 19, p. 773,774 Chem.Abstr., 1950 , p. 3480 |
|
~%
Benzamide,N-(4-... CAS#:81-45-8 |
| Literature: Gen. Aniline Works Patent: US1772311 , 1927 ; |
| Precursor 4 | |
|---|---|
| DownStream 8 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
| 1-Chloro-4-benzamidoanthraquinone |
| BENZAMIDE,N-(4-CHLORO-1-ANTHRAQUINONYL) |
| 1-Benzamido-4-chloroanthraquinone |
| 1Ba-4-Xa |
| 1-Benzoylamino-4-chlor-anthrachinon |
| N-(4-Chloro-9,10-dihydro-9,10-dioxo-1-anthracenyl)benzamide |
| 1-Benzoylamino-4-chloroanthraquinone |
| 1BA-4-XA [Russian] |
| Benzamide,N-(4-chloro-9,10-dihydro-9,10-dioxo-1-anthracenyl) |
| N-(4-Chlor-9,10-dioxo-9,10-dihydro-[1]anthryl)-benzamid |
| 4-Benzamido-1-chloroanthraquinone |
| Chlorobenzone |
| 1-Chloro-4-benzoylaminoanthraquinone |
| N-(4-chloro-9,10-dioxo-9,10-dihydro-[1]anthryl)-benzamide |