Benzoic acid,2,2'-[(9,10-dihydro-9,10-dioxo-1,5-anthracenediyl)diimino]bis structure
|
Common Name | Benzoic acid,2,2'-[(9,10-dihydro-9,10-dioxo-1,5-anthracenediyl)diimino]bis | ||
|---|---|---|---|---|
| CAS Number | 81-78-7 | Molecular Weight | 478.45200 | |
| Density | 1.513g/cm3 | Boiling Point | 730.7ºC at 760 mmHg | |
| Molecular Formula | C28H18N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 395.7ºC | |
| Name | 2-[[5-(2-carboxyanilino)-9,10-dioxoanthracen-1-yl]amino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.513g/cm3 |
|---|---|
| Boiling Point | 730.7ºC at 760 mmHg |
| Molecular Formula | C28H18N2O6 |
| Molecular Weight | 478.45200 |
| Flash Point | 395.7ºC |
| Exact Mass | 478.11600 |
| PSA | 132.80000 |
| LogP | 5.49160 |
| Index of Refraction | 1.769 |
| InChIKey | VBKQODJWSGDGNQ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1Nc1cccc2c1C(=O)c1cccc(Nc3ccccc3C(=O)O)c1C2=O |
|
~%
Benzoic acid,2,... CAS#:81-78-7 |
| Literature: BASF Patent: DE234977 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 10, p. 713 |
|
~%
Benzoic acid,2,... CAS#:81-78-7 |
| Literature: Ullmann; Ochsner Justus Liebigs Annalen der Chemie, 1911 , vol. 381, p. 8 |
|
~%
Detail
Learn More
|
| Literature: Ullmann; Ochsner Justus Liebigs Annalen der Chemie, 1911 , vol. 381, p. 8 |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| N,N'-(9,10-Dioxo-9,10-dihydro-anthracen-1,5-diyl)-di-anthranilsaeure |
| 2,2'-[(9,10-dihydro-9,10-dioxo-1,5-anthrylene)diimino]bisbenzoic acid |
| Anthraquinone-1,5-bis-anthranilic acid |
| 1,5-Bis(2-carboxyanilino)anthraquinone |
| 1.5-Bis-(2-carboxy-anilino)-anthrachinon |
| 1,5-Bis(2-carboxyanilino)-9,10-anthracenedione |
| Acridylic Acid |
| Vulcan Violet BN |
| N,N'-(9,10-dioxo-9,10-dihydro-anthracene-1,5-diyl)-di-anthranilic acid |
| Violet BN Acid Anthraquinone |