Phenolphthalol structure
|
Common Name | Phenolphthalol | ||
|---|---|---|---|---|
| CAS Number | 81-92-5 | Molecular Weight | 306.35500 | |
| Density | 1.258g/cm3 | Boiling Point | 513ºC at 760 mmHg | |
| Molecular Formula | C20H18O3 | Melting Point | 204ºC | |
| MSDS | N/A | Flash Point | 241.1ºC | |
Use of PhenolphthalolPhenolphthalol is a laxative in drug preparations and also estrogenically active[1]. |
| Name | 4-[[2-(hydroxymethyl)phenyl]-(4-hydroxyphenyl)methyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Description | Phenolphthalol is a laxative in drug preparations and also estrogenically active[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.258g/cm3 |
|---|---|
| Boiling Point | 513ºC at 760 mmHg |
| Melting Point | 204ºC |
| Molecular Formula | C20H18O3 |
| Molecular Weight | 306.35500 |
| Flash Point | 241.1ºC |
| Exact Mass | 306.12600 |
| PSA | 60.69000 |
| LogP | 3.77030 |
| Index of Refraction | 1.663 |
| InChIKey | CREICILGVGNQBH-UHFFFAOYSA-N |
| SMILES | OCc1ccccc1C(c1ccc(O)cc1)c1ccc(O)cc1 |
| HS Code | 2907299090 |
|---|
|
~%
Phenolphthalol CAS#:81-92-5 |
| Literature: Hubacher Journal of the American Chemical Society, 1952 , vol. 74, p. 5216 |
|
~%
Phenolphthalol CAS#:81-92-5 |
| Literature: Schultz; Schnekenburger Archiv der Pharmazie (Weinheim, Germany), 1958 , vol. 291, p. 362,366 |
|
~%
Phenolphthalol CAS#:81-92-5 |
| Literature: Schultz; Geller Archiv der Pharmazie (Weinheim, Germany), 1955 , vol. 288, p. 234,245 |
|
~%
Phenolphthalol CAS#:81-92-5 |
| Literature: Baeyer Justus Liebigs Annalen der Chemie, 1880 , vol. 202, p. 56,63 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| Regmolax |
| Bis-(4-oxy-phenyl)-(2-oxymethyl-phenyl)-methan |
| 4'.4''.21-Trioxy-2-methyl-triphenylmethan |
| Velaxin |
| 4'.4''-Dioxy-2-oxymethyl-triphenylmethan |
| 2-(bis(4-hydroxyphenyl)methyl)-benzenemethanol |
| 2-[Bis(4-hydroxyphenyl)methyl]benzyl Alcohol |
| Phenolphthalol |
| Benzenemethanol,2-[bis(4-hydroxyphenyl)methyl] |
| Egmol |
| 2-(4,4'-Dihydroxy-benzhydryl)-benzylalkohol |
| EINECS 201-386-5 |
| 2-(4,4'-dihydroxy-benzhydryl)-benzyl alcohol |
| Normolax |
| o-(Bis(p-hydroxyphenyl)methyl)benzyl alcohol |