phenolphthalin structure
|
Common Name | phenolphthalin | ||
|---|---|---|---|---|
| CAS Number | 81-90-3 | Molecular Weight | 320.33900 | |
| Density | 1.323g/cm3 | Boiling Point | 548.7ºC at 760 mmHg | |
| Molecular Formula | C20H16O4 | Melting Point | 238ºC | |
| MSDS | Chinese USA | Flash Point | 299.7ºC | |
| Name | 2-[bis(4-hydroxyphenyl)methyl]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.323g/cm3 |
|---|---|
| Boiling Point | 548.7ºC at 760 mmHg |
| Melting Point | 238ºC |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.33900 |
| Flash Point | 299.7ºC |
| Exact Mass | 320.10500 |
| PSA | 77.76000 |
| LogP | 3.97620 |
| Index of Refraction | 1.5400 (estimate) |
| InChIKey | FFFPYJTVNSSLBQ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1C(c1ccc(O)cc1)c1ccc(O)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 24/25 |
| RIDADR | NONH for all modes of transport |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
|
The effect of drinking milk containing conjugated linoleic acid on fecal microbiological profile, enzymatic activity, and fecal characteristics in humans.
Nutr. J. 6 , 15, (2007) The primary objective was to determine whether consumption of conjugated linoleic acids (CLAs) affected the fecal microbiota composition, fecal enzyme activity or fecal composition.Human subjects cons... |
| EINECS 201-384-4 |
| 4'.4''-Dioxy-triphenylmethan-carbonsaeure-(2) |
| 2-(4,4'-dihydroxy-benzhydryl)-benzoic acid |
| Benzoic acid,2-(bis(4-hydroxyphenyl)methyl) |
| 2-[Bis(4-hydroxyphenyl)-methyl]benzoic acid |
| Phenolphthalin |
| MFCD00036135 |
| 2-(4,4'-Dihydroxy-benzhydryl)-benzoesaeure |
| DSSTox_CID_2439 |
| dihydrophenolphthalein |