(S)-Metoprolol structure
|
Common Name | (S)-Metoprolol | ||
|---|---|---|---|---|
| CAS Number | 81024-42-2 | Molecular Weight | 267.364 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 398.6±37.0 °C at 760 mmHg | |
| Molecular Formula | C15H25NO3 | Melting Point | 41-43ºC | |
| MSDS | N/A | Flash Point | 194.9±26.5 °C | |
| Name | (2S)-1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 398.6±37.0 °C at 760 mmHg |
| Melting Point | 41-43ºC |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.364 |
| Flash Point | 194.9±26.5 °C |
| Exact Mass | 267.183441 |
| PSA | 50.72000 |
| LogP | 1.79 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.508 |
| InChIKey | IUBSYMUCCVWXPE-AWEZNQCLSA-N |
| SMILES | COCCc1ccc(OCC(O)CNC(C)C)cc1 |
| Storage condition | -20°C Freezer, Under Inert Atmosphere |
| HS Code | 2922509090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Propanol, 1-[4-(2-methoxyethyl)phenoxy]-3-[(1-methylethyl)amino]-, (2S)- |
| l-Metoprolol |
| (S)-1-isopropylamino-3-[4-(2-metoxyethyl)phenoxy]propan-2-ol |
| (2S)-1-[4-(2-methoxyethyl)phenoxy]-3-(propan-2-ylamino)propan-2-ol |
| (2S)-1-(Isopropylamino)-3-[4-(2-methoxyethyl)phenoxy]-2-propanol |
| (S)-(-)-Metoprolol |
| 2-Propanol, 1-(4-(2-methoxyethyl)phenoxy)-3-((1-methylethyl)amino)-, (2S)- |
| (2S)-1-isopropylamino-3-[p-(2-methoxyethyl)phenoxy]-2-propanol |
| (-)-Metoprolol |
| (S)-1-Isopropylamino-3-p-(2-methoxyethyl)phenoxy-propan-2-ol |
| (S)-1-(Isopropylamino)-3-(4-(2-methoxyethyl)phenoxy)propan-2-ol |