4-[[17-(5-ethyl-6-methyl-heptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-oxo-butanoic acid structure
|
Common Name | 4-[[17-(5-ethyl-6-methyl-heptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-oxo-butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 81125-67-9 | Molecular Weight | 514.77900 | |
| Density | 1.05g/cm3 | Boiling Point | 603.7ºC at 760 mmHg | |
| Molecular Formula | C33H54O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.6ºC | |
| Name | 4-[[17-(5-ethyl-6-methylheptan-2-yl)-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.05g/cm3 |
|---|---|
| Boiling Point | 603.7ºC at 760 mmHg |
| Molecular Formula | C33H54O4 |
| Molecular Weight | 514.77900 |
| Flash Point | 181.6ºC |
| Exact Mass | 514.40200 |
| PSA | 63.60000 |
| LogP | 8.44050 |
| Index of Refraction | 1.525 |
| InChIKey | QTSGGWZGUWTEOK-UHFFFAOYSA-N |
| SMILES | CCC(CCC(C)C1CCC2C3CC=C4CC(OC(=O)CCC(=O)O)CCC4(C)C3CCC12C)C(C)C |
|
~99%
4-[[17-(5-ethyl... CAS#:81125-67-9 |
| Literature: Klumphu, Piyatida; Lipshutz, Bruce H. Journal of Organic Chemistry, 2014 , vol. 79, # 3 p. 888 - 900 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| succinic acid mono-[17-(4-ethyl-1,5-dimethylhexyl)-10,13-dimethyl-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] ester |
| SITOSTEROL,HEMISUCCINATE |
| phytosterol hemisuccinate |