AKOS B018312 structure
|
Common Name | AKOS B018312 | ||
|---|---|---|---|---|
| CAS Number | 81154-13-4 | Molecular Weight | 237.29800 | |
| Density | 1.56g/cm3 | Boiling Point | 416.8ºC at 760 mmHg | |
| Molecular Formula | C10H7NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.9ºC | |
| Name | (5E)-5-[(4-hydroxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|
| Density | 1.56g/cm3 |
|---|---|
| Boiling Point | 416.8ºC at 760 mmHg |
| Molecular Formula | C10H7NO2S2 |
| Molecular Weight | 237.29800 |
| Flash Point | 205.9ºC |
| Exact Mass | 236.99200 |
| PSA | 113.76000 |
| LogP | 1.72790 |
| Index of Refraction | 1.776 |
| InChIKey | RAYIDZVPIAJJPF-VMPITWQZSA-N |
| SMILES | O=C1NC(=S)SC1=Cc1ccc(O)cc1 |
| HS Code | 2934999090 |
|---|
|
~90%
AKOS B018312 CAS#:81154-13-4 |
| Literature: Kumar, B. R. Prashantha; Karvekar; Adhikary; Nanjan; Suresh Journal of Heterocyclic Chemistry, 2006 , vol. 43, # 4 p. 897 - 903 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |