[2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]methanol structure
|
Common Name | [2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]methanol | ||
|---|---|---|---|---|
| CAS Number | 81168-17-4 | Molecular Weight | 252.42500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H24O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]methanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H24O2Si |
|---|---|
| Molecular Weight | 252.42500 |
| Exact Mass | 252.15500 |
| PSA | 29.46000 |
| LogP | 3.70070 |
| InChIKey | RCLKRJCBLSQBFJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccccc1CO |
|
~97%
[2-[[tert-butyl... CAS#:81168-17-4 |
| Literature: Aeissa, Christophe; Fuerstner, Alois Journal of the American Chemical Society, 2007 , vol. 129, # 48 p. 14836 - 14837 |
|
~0%
[2-[[tert-butyl... CAS#:81168-17-4 |
| Literature: Bristol-Myers Squibb Company Patent: US5272171 A1, 1993 ; |
| {2-[(tert-butyldimethylsilanyloxy)methyl]phenyl}methanol |
| Benzenemethanol,2-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl] |
| 2-(2-tert-butyldimethylsilyloxymethyl)benzyl alcohol |
| 1-(t-Butyldimethylsilyloxy)methyl-2-(hydroxymethyl)benzene |
| (2-(((tert-butyldimethylsilyl)oxy)methyl)phenyl)methanol |
| 2-tert-butyldimethylsilyloxymethylbenzyl alcohol |
| 2-(tert-butyldimethylsiloxymethyl)benzyl alcohol |