[(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]urea structure
|
Common Name | [(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]urea | ||
|---|---|---|---|---|
| CAS Number | 81263-72-1 | Molecular Weight | 299.32400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(3-methoxy-4-phenylmethoxyphenyl)methylideneamino]urea |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H17N3O3 |
|---|---|
| Molecular Weight | 299.32400 |
| Exact Mass | 299.12700 |
| PSA | 86.93000 |
| LogP | 3.18110 |
| InChIKey | AUNGYZXTMLWWPP-UHFFFAOYSA-N |
| SMILES | COc1cc(C=NNC(N)=O)ccc1OCc1ccccc1 |
| HS Code | 2928000090 |
|---|
|
~94%
[(3-methoxy-4-p... CAS#:81263-72-1 |
| Literature: Soliman; Shafik; Darwish Journal of Pharmaceutical Sciences, 1982 , vol. 71, # 2 p. 178 - 182 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| p-benzyloxy-m-methoxybenzaldehyde semicarbazone |
| Hydrazinecarboxamide,2-[[3-methoxy-4-(phenylmethoxy)phenyl]methylene] |
| 4-Benzyloxy-3-methoxybenzaldehyde semicarbazone |