CHEMBRDG-BB 6750243
Modify Date: 2025-09-10 18:03:31
CHEMBRDG-BB 6750243 structure
|
Common Name | CHEMBRDG-BB 6750243 | ||
|---|---|---|---|---|
| CAS Number | 812642-67-4 | Molecular Weight | 273.08000 | |
| Density | 1.612g/cm3 | Boiling Point | 412.5ºC at 760 mmHg | |
| Molecular Formula | C10H9BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.3ºC | |
| Name | 2-(2-bromo-4-formylphenoxy)propanoic acid |
|---|
| Density | 1.612g/cm3 |
|---|---|
| Boiling Point | 412.5ºC at 760 mmHg |
| Molecular Formula | C10H9BrO4 |
| Molecular Weight | 273.08000 |
| Flash Point | 203.3ºC |
| Exact Mass | 271.96800 |
| PSA | 63.60000 |
| LogP | 2.11350 |
| Index of Refraction | 1.603 |
| InChIKey | HOPBEIMHXUNAGU-UHFFFAOYSA-N |
| SMILES | CC(Oc1ccc(C=O)cc1Br)C(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |