2-(4-formyl-2,6-dimethoxyphenoxy)propanoic acid
Modify Date: 2025-09-02 10:51:21
2-(4-formyl-2,6-dimethoxyphenoxy)propanoic acid structure
|
Common Name | 2-(4-formyl-2,6-dimethoxyphenoxy)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 812642-68-5 | Molecular Weight | 254.23600 | |
| Density | 1.264g/cm3 | Boiling Point | 425.3ºC at 760 mmHg | |
| Molecular Formula | C12H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.8ºC | |
| Name | 2-(4-formyl-2,6-dimethoxyphenoxy)propanoic acid |
|---|
| Density | 1.264g/cm3 |
|---|---|
| Boiling Point | 425.3ºC at 760 mmHg |
| Molecular Formula | C12H14O6 |
| Molecular Weight | 254.23600 |
| Flash Point | 162.8ºC |
| Exact Mass | 254.07900 |
| PSA | 82.06000 |
| LogP | 1.36820 |
| Index of Refraction | 1.547 |
| InChIKey | ZZTPVGFRGWPXEF-UHFFFAOYSA-N |
| SMILES | COc1cc(C=O)cc(OC)c1OC(C)C(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |