2-(4-formyl-2,6-dimethoxyphenoxy)acetic acid structure
|
Common Name | 2-(4-formyl-2,6-dimethoxyphenoxy)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 812642-73-2 | Molecular Weight | 240.20900 | |
| Density | 1.303g/cm3 | Boiling Point | 424.3ºC at 760 mmHg | |
| Molecular Formula | C11H12O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.2ºC | |
| Name | 2-(4-formyl-2,6-dimethoxyphenoxy)acetic acid |
|---|
| Density | 1.303g/cm3 |
|---|---|
| Boiling Point | 424.3ºC at 760 mmHg |
| Molecular Formula | C11H12O6 |
| Molecular Weight | 240.20900 |
| Flash Point | 166.2ºC |
| Exact Mass | 240.06300 |
| PSA | 82.06000 |
| LogP | 0.97970 |
| Index of Refraction | 1.556 |
| InChIKey | NNJAVTAELGZGLF-UHFFFAOYSA-N |
| SMILES | COc1cc(C=O)cc(OC)c1OCC(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |