4β,15-diacetoxy-9β,10β-epoxyscirpen-3-one structure
|
Common Name | 4β,15-diacetoxy-9β,10β-epoxyscirpen-3-one | ||
|---|---|---|---|---|
| CAS Number | 81331-30-8 | Molecular Weight | 380.38900 | |
| Density | 1.39g/cm3 | Boiling Point | 479.8ºC at 760 mmHg | |
| Molecular Formula | C19H24O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.3ºC | |
| Name | 4β,15-diacetoxy-9β,10β-epoxyscirpen-3-one |
|---|
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 479.8ºC at 760 mmHg |
| Molecular Formula | C19H24O8 |
| Molecular Weight | 380.38900 |
| Flash Point | 210.3ºC |
| Exact Mass | 380.14700 |
| PSA | 103.96000 |
| LogP | 0.54430 |
| Index of Refraction | 1.565 |
| InChIKey | YOJOUEVWVFOYQS-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC12CCC3(C)OC3C1OC1C(=O)C(OC(C)=O)C2(C)C12CO2 |
|
~91%
4β,15-diacetoxy... CAS#:81331-30-8 |
| Literature: Kaneko; Schmitz; Essery; Rose; Howell; O'Herron; Nachfolger; Huftalen; Bradner; Partyka; Doyle; Davies; Cundliffe Journal of Medicinal Chemistry, 1982 , vol. 25, # 5 p. 579 - 589 |
|
~%
4β,15-diacetoxy... CAS#:81331-30-8 |
| Literature: Kaneko; Schmitz; Essery; Rose; Howell; O'Herron; Nachfolger; Huftalen; Bradner; Partyka; Doyle; Davies; Cundliffe Journal of Medicinal Chemistry, 1982 , vol. 25, # 5 p. 579 - 589 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |