2-[4-(3-amino-2-hydroxypropoxy)phenyl]acetamide structure
|
Common Name | 2-[4-(3-amino-2-hydroxypropoxy)phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 81346-71-6 | Molecular Weight | 224.25600 | |
| Density | 1.234g/cm3 | Boiling Point | 524.8ºC at 760 mmHg | |
| Molecular Formula | C11H16N2O3 | Melting Point | 169-173ºC | |
| MSDS | USA | Flash Point | 271.2ºC | |
| Name | 2-[4-(3-amino-2-hydroxypropoxy)phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.234g/cm3 |
|---|---|
| Boiling Point | 524.8ºC at 760 mmHg |
| Melting Point | 169-173ºC |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.25600 |
| Flash Point | 271.2ºC |
| Exact Mass | 224.11600 |
| PSA | 98.57000 |
| LogP | 0.81340 |
| Index of Refraction | 1.578 |
| InChIKey | UWMXVJVTKRSOPW-UHFFFAOYSA-N |
| SMILES | NCC(O)COc1ccc(CC(N)=O)cc1 |
|
~%
2-[4-(3-amino-2... CAS#:81346-71-6 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 30, # 1 p. 196 - 201 |
|
~%
2-[4-(3-amino-2... CAS#:81346-71-6 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 30, # 1 p. 196 - 201 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-(3-AMINO-2-HYDROXYPROPOXY)PHENYLACETAMIDE |
| 2[4-(3-Amino-2-hydroxy-propoxy)-phenyl]-acetamide |