2-[4-(3-Chloro-2-hydroxypropoxy)phenyl]acetamide structure
|
Common Name | 2-[4-(3-Chloro-2-hydroxypropoxy)phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 115538-83-5 | Molecular Weight | 243.687 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 492.5±40.0 °C at 760 mmHg | |
| Molecular Formula | C11H14ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.7±27.3 °C | |
| Name | 2-[4-(3-chloro-2-hydroxypropoxy)phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 492.5±40.0 °C at 760 mmHg |
| Molecular Formula | C11H14ClNO3 |
| Molecular Weight | 243.687 |
| Flash Point | 251.7±27.3 °C |
| Exact Mass | 243.066223 |
| PSA | 72.55000 |
| LogP | 0.00 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | OQFMSHFNOSFLJU-UHFFFAOYSA-N |
| SMILES | NC(=O)Cc1ccc(OCC(O)CCl)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
2-[4-(3-Chloro-... CAS#:115538-83-5 |
| Literature: Bevinakatti; Banerji Journal of Organic Chemistry, 1992 , vol. 57, # 22 p. 6003 - 6005 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-[4-(3-Chloro-2-hydroxypropoxy)phenyl]acetamide |
| Benzeneacetamide, 4-(3-chloro-2-hydroxypropoxy)- |
| Atenolol Impurity 4 |