Naphtho[1,2-d]thiazol-5-ol,4-methyl-2-(2-propen-1-ylamino)-, hydrochloride (1:1) structure
|
Common Name | Naphtho[1,2-d]thiazol-5-ol,4-methyl-2-(2-propen-1-ylamino)-, hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 81466-82-2 | Molecular Weight | 306.81000 | |
| Density | 1.334g/cm3 | Boiling Point | 466.3ºC at 760mmHg | |
| Molecular Formula | C15H15ClN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.8ºC | |
| Name | 4-methyl-2-(prop-2-enylamino)benzo[e][1,3]benzothiazol-5-ol |
|---|
| Density | 1.334g/cm3 |
|---|---|
| Boiling Point | 466.3ºC at 760mmHg |
| Molecular Formula | C15H15ClN2OS |
| Molecular Weight | 306.81000 |
| Flash Point | 235.8ºC |
| Exact Mass | 306.05900 |
| PSA | 73.39000 |
| LogP | 4.93640 |
| Index of Refraction | 1.764 |
| InChIKey | FGAOTPNMMQVQMS-UHFFFAOYSA-N |
| SMILES | C=CCNc1nc2c(s1)c(C)c(O)c1ccccc12 |
|
~71%
Naphtho[1,2-d]t... CAS#:81466-82-2 |
| Literature: Ulrich; Cerami Journal of Medicinal Chemistry, 1982 , vol. 25, # 6 p. 654 - 657 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |