9b-methyl-7-propan-2-yl-3,3b,4,5,10,11-hexahydronaphtho[2,1-e][2]benzofuran-1,6,9-trione structure
|
Common Name | 9b-methyl-7-propan-2-yl-3,3b,4,5,10,11-hexahydronaphtho[2,1-e][2]benzofuran-1,6,9-trione | ||
|---|---|---|---|---|
| CAS Number | 81478-15-1 | Molecular Weight | 326.38600 | |
| Density | 1.25g/cm3 | Boiling Point | 522.9ºC at 760 mmHg | |
| Molecular Formula | C20H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.1ºC | |
| Name | 9b-methyl-7-propan-2-yl-3,3b,4,5,10,11-hexahydronaphtho[2,1-e][2]benzofuran-1,6,9-trione |
|---|
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 522.9ºC at 760 mmHg |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.38600 |
| Flash Point | 231.1ºC |
| Exact Mass | 326.15200 |
| PSA | 60.44000 |
| LogP | 3.08070 |
| Index of Refraction | 1.584 |
| InChIKey | SZTABFBXCBBJRR-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=O)C2=C(CCC3C4=C(CCC23C)C(=O)OC4)C1=O |
|
~15%
9b-methyl-7-pro... CAS#:81478-15-1 |
| Literature: Lai, Chee Kong; Buckanin, Richard S.; Chen, Samuel J.; Zimmerman, Donna Frieze; Sher, Frank T.; Berchtold, Glenn A. Journal of Organic Chemistry, 1982 , vol. 47, # 12 p. 2364 - 2369 |