1-diethoxyphosphoryl-1a,9b-dihydrophenanthro[9,10-b]azirine structure
|
Common Name | 1-diethoxyphosphoryl-1a,9b-dihydrophenanthro[9,10-b]azirine | ||
|---|---|---|---|---|
| CAS Number | 81593-13-7 | Molecular Weight | 329.33000 | |
| Density | 1.28g/cm3 | Boiling Point | 449ºC at 760mmHg | |
| Molecular Formula | C18H20NO3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.4ºC | |
| Name | 1-diethoxyphosphoryl-1a,9b-dihydrophenanthro[9,10-b]azirine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 449ºC at 760mmHg |
| Molecular Formula | C18H20NO3P |
| Molecular Weight | 329.33000 |
| Flash Point | 225.4ºC |
| Exact Mass | 329.11800 |
| PSA | 48.35000 |
| LogP | 4.88400 |
| Index of Refraction | 1.614 |
| InChIKey | FICMXWSWATXNGC-DFNIBXOVSA-N |
| SMILES | CCOP(=O)(OCC)N1C2c3ccccc3-c3ccccc3C21 |
|
~72%
1-diethoxyphosp... CAS#:81593-13-7 |
| Literature: Weitzberg, Moshe; Aizenshtat, Zeev; Blum, Jochanan Journal of Heterocyclic Chemistry, 1981 , vol. 18, p. 1513 - 1516 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| diethyl 1a,9b-dihydro-1-phosphonato-1H-phenanthro<9,10-b>azirine |
| Phosphonic acid,(1a,9b-dihydro-1H-phenanthro(9,10-b)azirin-1-yl)-,diethyl ester |
| (1a,9b-Dihydro-1H-phenanthro(9,10-b)azirin-1-yl)phosphonic acid diethyl ester |
| N-(Diethylphosphoryl)phenanthrene 9,10-imine |