rehmannioside B structure
|
Common Name | rehmannioside B | ||
|---|---|---|---|---|
| CAS Number | 81720-06-1 | Molecular Weight | 524.47000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H32O15 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of rehmannioside BRehmannioside B is a desacyl derivative of Picrorhizaoside B, which can be isolated from the methanol extract of the rhizomes of Picrorhiza kurroa Royle ex Benth. (Plantaginaceae)[1]. |
| Name | rehmannioside B |
|---|
| Description | Rehmannioside B is a desacyl derivative of Picrorhizaoside B, which can be isolated from the methanol extract of the rhizomes of Picrorhiza kurroa Royle ex Benth. (Plantaginaceae)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C21H32O15 |
|---|---|
| Molecular Weight | 524.47000 |
| Exact Mass | 524.17400 |
| PSA | 240.75000 |
| InChIKey | DLYKKFLQWHNOKY-UHFFFAOYSA-N |
| SMILES | OCC1OC(OC2OC=CC3C(OC4OC(CO)C(O)C(O)C4O)C4OC4(CO)C23)C(O)C(O)C1O |
| Precursor 0 | |
|---|---|
| DownStream 1 | |