Kahweol acetate structure
|
Common Name | Kahweol acetate | ||
|---|---|---|---|---|
| CAS Number | 81760-47-6 | Molecular Weight | 356.45500 | |
| Density | 1.23g/cm3 | Boiling Point | 481ºC at 760 mmHg | |
| Molecular Formula | C22H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.7ºC | |
Use of Kahweol acetateKahweol Acetate is a semi-synthetic derivative of kahweol, a natural product found in coffee beans. It exhibits a wide variety of biological activities, including inhibiting RANKL-induced osteoclast generation, inducing cell cycle arrest and apoptosis in oral squamous cell carcinoma cells, preventing aflatoxin B1 induced DNA adduct formation, and suppressing H2O2-induced DNA damage and oxidative stress. |
| Name | Kahweol acetate |
|---|
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 481ºC at 760 mmHg |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.45500 |
| Flash Point | 244.7ºC |
| Exact Mass | 356.19900 |
| PSA | 59.67000 |
| LogP | 4.29070 |
| Index of Refraction | 1.594 |
| InChIKey | OJLWVPDNBQAHRT-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1(O)CC23CCC4c5ccoc5C=CC4(C)C2CCC1C3 |
|
~%
Kahweol acetate CAS#:81760-47-6 |
| Literature: Kaufmann; Sen Gupta Fette und Seifen, 1963 , vol. 65, p. 529 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |