6-Chloro Acyclovir Acetate structure
|
Common Name | 6-Chloro Acyclovir Acetate | ||
|---|---|---|---|---|
| CAS Number | 81777-48-2 | Molecular Weight | 285.68700 | |
| Density | 1.61g/cm3 | Boiling Point | 537.3ºC at 760 mmHg | |
| Molecular Formula | C10H12ClN5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.8ºC | |
| Name | 2-[(2-amino-6-chloropurin-9-yl)methoxy]ethyl acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.61g/cm3 |
|---|---|
| Boiling Point | 537.3ºC at 760 mmHg |
| Molecular Formula | C10H12ClN5O3 |
| Molecular Weight | 285.68700 |
| Flash Point | 278.8ºC |
| Exact Mass | 285.06300 |
| PSA | 105.88000 |
| LogP | 0.52920 |
| Index of Refraction | 1.676 |
| InChIKey | RAEGIEVTUAVTJO-UHFFFAOYSA-N |
| SMILES | CC(=O)OCCOCn1cnc2c(Cl)nc(N)nc21 |
|
~65%
6-Chloro Acyclo... CAS#:81777-48-2 |
| Literature: Stimac; Kobe Synthesis, 1990 , # 6 p. 461 - 464 |
|
~%
6-Chloro Acyclo... CAS#:81777-48-2 |
| Literature: Synthesis, , # 6 p. 461 - 464 |
|
~%
6-Chloro Acyclo... CAS#:81777-48-2 |
| Literature: Canadian Journal of Chemistry, , vol. 60, # 5 p. 547 - 553 |
| 9-[(2-Acetoxyethoxy)methyl]-2-amino-6-chloropurin |
| 9-<(2-acetoxyethoxy)methyl>-2-amino-6-chloropurine |
| 2-[(2-amino-6-chloro-9h-purin-9-yl)methoxy]ethyl acetate |
| 2-amino-6-chloro-9-(2-acetoxyethoxymethyl)purine |
| 9-[(2-acetoxyethoxy)methyl]-2-amino-6-chloro-9H-purine |
| 6-Chloro Acyclovir Acetate |