α-Fluoromethyl-L-histidine dihydrochloride structure
|
Common Name | α-Fluoromethyl-L-histidine dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 81839-27-2 | Molecular Weight | 260.094 | |
| Density | N/A | Boiling Point | 503.2±0.0 °C at 760 mmHg | |
| Molecular Formula | C7H12Cl2FN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.1±0.0 °C | |
Use of α-Fluoromethyl-L-histidine dihydrochloride(S)-alpha-Fluoromethylhistidine HCl is a potent irreversible histidine decarboxylase (HDC) inhibitor and glutathione S-transferase inhibitor. a-FMH was demonstrated to be an effective inhibitor of GST at micromolar concentration, suggesting that off-target effects of a-FMH may limit physiological drug metabolism and elimination by GST-dependent mechanisms. |
| Name | α-(Fluoromethyl)-L-histidine dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 503.2±0.0 °C at 760 mmHg |
|---|---|
| Molecular Formula | C7H12Cl2FN3O2 |
| Molecular Weight | 260.094 |
| Flash Point | 258.1±0.0 °C |
| Exact Mass | 259.029053 |
| Vapour Pressure | 0.0±0.0 mmHg at 25°C |
| InChIKey | LIJUCORJKQZTOS-XCUBXKJBSA-N |
| SMILES | Cl.Cl.NC(CF)(Cc1cnc[nH]1)C(=O)O |
| L-Histidine, α-(fluoromethyl)-, hydrochloride (1:2) |
| α-(Fluoromethyl)-L-histidine dihydrochloride |