8-Nitro-3,4-dihydro-2H-1,5-benzodioxepin-7-amine structure
|
Common Name | 8-Nitro-3,4-dihydro-2H-1,5-benzodioxepin-7-amine | ||
|---|---|---|---|---|
| CAS Number | 81864-62-2 | Molecular Weight | 210.18700 | |
| Density | 1.399g/cm3 | Boiling Point | 390.6ºC at 760 mmHg | |
| Molecular Formula | C9H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190ºC | |
| Name | 8-Nitro-3,4-dihydro-2H-1,5-benzodioxepin-7-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.399g/cm3 |
|---|---|
| Boiling Point | 390.6ºC at 760 mmHg |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.18700 |
| Flash Point | 190ºC |
| Exact Mass | 210.06400 |
| PSA | 90.30000 |
| LogP | 2.44270 |
| Index of Refraction | 1.614 |
| InChIKey | AFALZDMHQHIVNC-UHFFFAOYSA-N |
| SMILES | Nc1cc2c(cc1[N+](=O)[O-])OCCCO2 |
| HS Code | 2932999099 |
|---|
|
~49%
8-Nitro-3,4-dih... CAS#:81864-62-2 |
| Literature: Hadjimihalakis, Phaedon M. Journal of Heterocyclic Chemistry, 1991 , vol. 28, # 4 p. 1111 - 1114 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 7-nitro-3,4-dihydro-2H-1,5-benzodioxepin-8-amine |