Docosahexaenoic acid ethyl ester structure
|
Common Name | Docosahexaenoic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 81926-94-5 | Molecular Weight | 356.54 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H36O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Docosahexaenoic acid ethyl esterDocosahexaenoic acid ethyl ester (Ethyl docosahexaenoate) is a 90% concentrated ethyl ester of docosahexaenoic acid manufactured from the microalgal oil. Docosahexaenoic acid ethyl ester enhances 6-hydroxydopamine-induced neuronal damage by induction of lipid peroxidation in mouse striatum. Docosahexaenoic acid (DHA) is a key component of the cell membrane, and its peroxidation is inducible due to the double-bond chemical structure. Docosahexaenoic acid has neuroprotective effects[1][2]. |
| Name | ethyl (4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate |
|---|---|
| Synonym | More Synonyms |
| Description | Docosahexaenoic acid ethyl ester (Ethyl docosahexaenoate) is a 90% concentrated ethyl ester of docosahexaenoic acid manufactured from the microalgal oil. Docosahexaenoic acid ethyl ester enhances 6-hydroxydopamine-induced neuronal damage by induction of lipid peroxidation in mouse striatum. Docosahexaenoic acid (DHA) is a key component of the cell membrane, and its peroxidation is inducible due to the double-bond chemical structure. Docosahexaenoic acid has neuroprotective effects[1][2]. |
|---|---|
| Related Catalog | |
| In Vivo | Docosahexaenoic acid ethyl ester (DHA-EE) (500 mg/kg; IP; once daily for 7 days) enhances 6-OHDA-induced reduction of striatal dopamine level[2]. |
| References |
| Molecular Formula | C24H36O2 |
|---|---|
| Molecular Weight | 356.54 |
| Exact Mass | 355.26400 |
| PSA | 40.13000 |
| LogP | 5.99440 |
| InChIKey | ITNKVODZACVXDS-YNUSHXQLSA-N |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)OCC |
| Precursor 8 | |
|---|---|
| DownStream 5 | |
| cis-4,7,10,13,16,19-docosahexaneoic acid ethyl ester |
| ethyl-ester all cis 4,7,10,13,16,19-docosahexaenoate |
| (all-Z) |
| DHA ethyl ester |
| 4,7,10,13,16,19-docosahexaenoic acid ethyl ester |
| Doconexent [inn] |
| Docosahexaenoic Acid Ethyl Ester |
| 4Z,7Z,10Z,13Z,16Z,19Z-docosahexaenoic acid ethyl ester |
| (5Z,8Z,11Z,14Z)-5,8,11,14-Eicosatetraenoic Acid Ethyl Ester-d5 |
| Ethyl (all-Z)-docosa-4,7,10,13,16,19-hexaenoate |
| Docosahexanoic acid-[D5]-ethylester |