ditert-butyl-[[ditert-butylphosphanylmethyl(phenyl)boranyl]methyl]phosphane structure
|
Common Name | ditert-butyl-[[ditert-butylphosphanylmethyl(phenyl)boranyl]methyl]phosphane | ||
|---|---|---|---|---|
| CAS Number | 820219-05-4 | Molecular Weight | 406.37300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H45BP2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ditert-butyl-[[ditert-butylphosphanylmethyl(phenyl)boranyl]methyl]phosphane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H45BP2 |
|---|---|
| Molecular Weight | 406.37300 |
| Exact Mass | 406.30900 |
| PSA | 27.18000 |
| LogP | 8.46120 |
| InChIKey | CSZUMJVBKQWGGR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)P(CB(CP(C(C)(C)C)C(C)(C)C)c1ccccc1)C(C)(C)C |
|
~89%
ditert-butyl-[[... CAS#:820219-05-4 |
| Literature: Thomas, Christine M.; Mankad, Neal P.; Peters, Jonas C. Journal of the American Chemical Society, 2006 , vol. 128, # 15 p. 4956 - 4957 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Phosphine,[(phenylborylene)bis(methylene)]bis[bis(1,1-dimethylethyl) |
| PhB(CH2P((t)Bu)2)2 |