8,11a-Methano-11aH-cyclohepta[a]naphthalene-4-carboxylicacid, tetradecahydro-3,9-dihydroxy-9-(hydroxymethyl)-4,11b-dimethyl-, [3R-(3a,4a,4aa,6ab,8b,9b,11ab,11bb)]- (9CI) structure
|
Common Name | 8,11a-Methano-11aH-cyclohepta[a]naphthalene-4-carboxylicacid, tetradecahydro-3,9-dihydroxy-9-(hydroxymethyl)-4,11b-dimethyl-, [3R-(3a,4a,4aa,6ab,8b,9b,11ab,11bb)]- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 82026-05-9 | Molecular Weight | 352.46500 | |
| Density | 1.29g/cm3 | Boiling Point | 547.5ºC at 760 mmHg | |
| Molecular Formula | C20H32O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299ºC | |
| Name | 3α,16,17-trihydroxyaphidicolan-18-oate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 547.5ºC at 760 mmHg |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.46500 |
| Flash Point | 299ºC |
| Exact Mass | 352.22500 |
| PSA | 97.99000 |
| LogP | 2.17810 |
| Index of Refraction | 1.594 |
| InChIKey | BGVJVJFOQALRJT-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)O)C(O)CCC2(C)C1CCC1CC3CC12CCC3(O)CO |
|
~41%
8,11a-Methano-1... CAS#:82026-05-9 |
| Literature: Ipsen, John; Fuska, Jan; Foskova, A.; Rosazza, John P. Journal of Organic Chemistry, 1982 , vol. 47, # 17 p. 3278 - 3282 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| aphidicolin,18-carboxy |