aphidicolin, 3-keto structure
|
Common Name | aphidicolin, 3-keto | ||
|---|---|---|---|---|
| CAS Number | 82026-06-0 | Molecular Weight | 336.46600 | |
| Density | 1.22g/cm3 | Boiling Point | 506.9ºC at 760 mmHg | |
| Molecular Formula | C20H32O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.5ºC | |
| Name | aphidicolin, 3-keto |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 506.9ºC at 760 mmHg |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.46600 |
| Flash Point | 274.5ºC |
| Exact Mass | 336.23000 |
| PSA | 77.76000 |
| LogP | 2.29400 |
| Index of Refraction | 1.577 |
| InChIKey | PCKFULMONJBMIR-UHFFFAOYSA-N |
| SMILES | CC1(CO)C(=O)CCC2(C)C1CCC1CC3CC12CCC3(O)CO |
|
~25%
aphidicolin, 3-keto CAS#:82026-06-0 |
| Literature: Ipsen, John; Fuska, Jan; Foskova, A.; Rosazza, John P. Journal of Organic Chemistry, 1982 , vol. 47, # 17 p. 3278 - 3282 |
|
~%
aphidicolin, 3-keto CAS#:82026-06-0 |
| Literature: Ipsen, John; Fuska, Jan; Foskova, A.; Rosazza, John P. Journal of Organic Chemistry, 1982 , vol. 47, # 17 p. 3278 - 3282 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 16,17,18-trihydroxyaphidicolan-3-one |
| 3-ketoaphidicolin |