umf 060 structure
|
Common Name | umf 060 | ||
|---|---|---|---|---|
| CAS Number | 82050-12-2 | Molecular Weight | 315.299 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H14FN3O3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | methyl N-[6-[(4-fluorophenyl)-hydroxymethyl]-1H-benzimidazol-2-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C16H14FN3O3 |
| Molecular Weight | 315.299 |
| Exact Mass | 315.101929 |
| PSA | 90.73000 |
| LogP | 2.10 |
| Index of Refraction | 1.698 |
| InChIKey | GONRXGWUUBPRKF-UHFFFAOYSA-N |
| SMILES | COC(=O)Nc1nc2ccc(C(O)c3ccc(F)cc3)cc2[nH]1 |
| RIDADR | NONH for all modes of transport |
|---|
|
Biotransformation of anthelmintics and the activity of drug-metabolizing enzymes in the tapeworm Moniezia expansa.
Parasitology 142(5) , 648-59, (2015) The sheep tapeworm Moniezia expansa is very common parasite, which affects ruminants such as sheep, goats as well as other species. The benzimidazole anthelmintics albendazole (ABZ), flubendazole (FLU... |
| Hydroxy Flubendazole |
| N-[6-[(4-Fluorophenyl)hydroxymethyl]-1H-benzimidazol-2-yl]carbamic Acid Methyl Ester |
| methyl [5-[(4-fluorophenyl)hydroxymethyl]-1H-benzimidazol-2-yl]carbamate |
| Reduced-flubendazole |
| UMF 060 |
| Carbamic acid, N-[6-[(4-fluorophenyl)hydroxymethyl]-1H-benzimidazol-2-yl]-, methyl ester |
| Methyl {6-[(4-fluorophenyl)(hydroxy)methyl]-1H-benzimidazol-2-yl}carbamate |
| [5-[(4-Fluorophenyl)hydroxymethyl]-1H-benzimidazol-2-yl]carbamic Acid Methyl Ester |