Thiolactomycin structure
|
Common Name | Thiolactomycin | ||
|---|---|---|---|---|
| CAS Number | 82079-32-1 | Molecular Weight | 210.29300 | |
| Density | 1.214g/cm3 | Boiling Point | 319.2ºC at 760 mmHg | |
| Molecular Formula | C11H14O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146.8ºC | |
Use of ThiolactomycinThiolactomycin is an antibiotic. Thiolactomycin is active against Gram-negative anaerobes. Thiolactomycin also inhibits malaria and trypanosomes. Thiolactomycin is a FabB inhibitor. Thiolactomycin inhibits the synthesis of fatty acids and mycolic acids[1][2]. |
| Name | (2R)-5-hydroxy-2,4-dimethyl-2-[(1E)-2-methylbuta-1,3-dienyl]thiophen-3-one |
|---|---|
| Synonym | More Synonyms |
| Description | Thiolactomycin is an antibiotic. Thiolactomycin is active against Gram-negative anaerobes. Thiolactomycin also inhibits malaria and trypanosomes. Thiolactomycin is a FabB inhibitor. Thiolactomycin inhibits the synthesis of fatty acids and mycolic acids[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.214g/cm3 |
|---|---|
| Boiling Point | 319.2ºC at 760 mmHg |
| Molecular Formula | C11H14O2S |
| Molecular Weight | 210.29300 |
| Flash Point | 146.8ºC |
| Exact Mass | 210.07100 |
| PSA | 62.60000 |
| LogP | 2.98280 |
| Index of Refraction | 1.632 |
| InChIKey | SYQNUQSGEWNWKV-XUIVZRPNSA-N |
| SMILES | C=CC(C)=CC1(C)SC(=O)C(C)=C1O |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| [R-(E)]-4-Hydroxy-3,5-dimethyl-5-(2-methyl-1,3-butadienyl)-2(5H)-thiophenone |
| 2(5H)-Thiophenone,3,5-dimethyl-4-hydroxy-5-(2-methyl-1,3-butadienyl)-,(R-(E)) |
| Antibiotic 2-200 |
| MFCD01940028 |
| TLM |
| (+)-Thiolactomycin |
| (R,E)-4-hydroxy-3,5-dimethyl-5-(2-methylbuta-1,3-dienyl)thiophen-2(5H)-one |
| (R-(E))-3,5-Dimethyl-4-hydroxy-5-(2-methyl-1,3-butadienyl)-2(5H)-thiophenone |
| (5R)-4-hydroxy-3,5-dimethyl-5-(2-methyl-buta-1,3-dienyl)-5-H-thiophen-2-one |
| (R)-(+)-Thiolactomycin |
| 5R-Thiolactomycin |