1-Methyl-3-(1-oxopropyl)-5-(3-(trifluoromethyl)phenyl)-4(1H)-pyridinon e
1-Methyl-3-(1-oxopropyl)-5-(3-(trifluoromethyl)phenyl)-4(1H)-pyridinon e structure
|
Common Name | 1-Methyl-3-(1-oxopropyl)-5-(3-(trifluoromethyl)phenyl)-4(1H)-pyridinon e | ||
|---|---|---|---|---|
| CAS Number | 82129-63-3 | Molecular Weight | 309.28300 | |
| Density | 1.277g/cm3 | Boiling Point | 418ºC at 760 mmHg | |
| Molecular Formula | C16H14F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-methyl-3-propanoyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.277g/cm3 |
|---|---|
| Boiling Point | 418ºC at 760 mmHg |
| Molecular Formula | C16H14F3NO2 |
| Molecular Weight | 309.28300 |
| Flash Point | 206.6ºC |
| Exact Mass | 309.09800 |
| PSA | 39.07000 |
| LogP | 3.66380 |
| Index of Refraction | 1.522 |
| InChIKey | DSUOBRWDEMOYOE-UHFFFAOYSA-N |
| SMILES | CCC(=O)c1cn(C)cc(-c2cccc(C(F)(F)F)c2)c1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1-Methyl-3-(1-o... CAS#:82129-63-3 |
| Literature: Abdulla, Riaz F.; Morgan, Lawrence A.; Williams, James C. Heterocycles, 1983 , vol. 20, # 11 p. 2189 - 2195 |
|
~%
1-Methyl-3-(1-o... CAS#:82129-63-3 |
| Literature: Abdulla, Riaz F.; Morgan, Lawrence A.; Williams, James C. Heterocycles, 1983 , vol. 20, # 11 p. 2189 - 2195 |
![Ethyl [3-(trifluoromethyl)phenyl]acetate structure](https://image.chemsrc.com/caspic/492/331-33-9.png)
![1-[3-(trifluoromethyl)phenyl]hexane-2,4-dione structure](https://image.chemsrc.com/caspic/148/82129-64-4.png)
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-methyl-3-propanoyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one? |
| A: The English name of 1-methyl-3-propanoyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one is 1-methyl-3-propanoyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one. |
| Q: What is the CAS number of 1-methyl-3-propanoyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one? |
| A: CAS number of 1-methyl-3-propanoyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one is 82129-63-3. |
| Q: What is the polar surface area (PSA) of 1-methyl-3-propanoyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one? |
| A: Polar surface area (PSA) of 1-methyl-3-propanoyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one is 39.07000. |
| Q: What is the SMILES notation of 1-methyl-3-propanoyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one? |
| A: SMILES notation of 1-methyl-3-propanoyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one is CCC(=O)c1cn(C)cc(-c2cccc(C(F)(F)F)c2)c1=O. |
| Q: What is the LogP of 1-methyl-3-propanoyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one? |
| A: LogP of 1-methyl-3-propanoyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one is 3.66380. |
| Q: What is the Chinese name of 82129-63-3? |
| A: Chinese name of 82129-63-3 is 82129-63-3. |
| Q: What is the molecular formula of 1-methyl-3-propanoyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one? |
| A: Molecular formula of 1-methyl-3-propanoyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one is C16H14F3NO2. |
| Q: What is the molecular weight of 1-methyl-3-propanoyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one? |
| A: Molecular weight of 1-methyl-3-propanoyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one is 309.28300. |
| Q: What is the boiling point of 1-methyl-3-propanoyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one? |
| A: Boiling point of 1-methyl-3-propanoyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one is 418ºC at 760 mmHg. |
| Q: What is the InChIKey of 1-methyl-3-propanoyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one? |
| A: InChIKey of 1-methyl-3-propanoyl-5-[3-(trifluoromethyl)phenyl]pyridin-4-one is DSUOBRWDEMOYOE-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |