2-nitro-3-methoxy-α-(oxo)benzenoacetic acid
2-nitro-3-methoxy-α-(oxo)benzenoacetic acid structure
|
Common Name | 2-nitro-3-methoxy-α-(oxo)benzenoacetic acid | ||
|---|---|---|---|---|
| CAS Number | 82204-33-9 | Molecular Weight | 239.18200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-nitro-3-methoxy-α-(oxo)benzenoacetic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H9NO6 |
|---|---|
| Molecular Weight | 239.18200 |
| Exact Mass | 239.04300 |
| PSA | 109.42000 |
| LogP | 1.32280 |
| InChIKey | DLKACZAQOCIILN-UHFFFAOYSA-N |
| SMILES | COc1cccc(CC(=O)C(=O)O)c1[N+](=O)[O-] |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:20876-31-7
CAS#:24610-33-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (3-methoxy-2-nitro-phenyl)-pyruvic acid |
| (3-Methoxy-2-nitro-phenyl)-brenztraubensaeure |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-nitro-3-methoxy-α-(oxo)benzenoacetic acid? |
| A: Molecular formula of 2-nitro-3-methoxy-α-(oxo)benzenoacetic acid is C10H9NO6. |
| Q: What is the CAS number of 2-nitro-3-methoxy-α-(oxo)benzenoacetic acid? |
| A: CAS number of 2-nitro-3-methoxy-α-(oxo)benzenoacetic acid is 82204-33-9. |
| Q: What is the molecular weight of 2-nitro-3-methoxy-α-(oxo)benzenoacetic acid? |
| A: Molecular weight of 2-nitro-3-methoxy-α-(oxo)benzenoacetic acid is 239.18200. |
| Q: What is the SMILES notation of 2-nitro-3-methoxy-α-(oxo)benzenoacetic acid? |
| A: SMILES notation of 2-nitro-3-methoxy-α-(oxo)benzenoacetic acid is COc1cccc(CC(=O)C(=O)O)c1[N+](=O)[O-]. |
| Q: What is the LogP of 2-nitro-3-methoxy-α-(oxo)benzenoacetic acid? |
| A: LogP of 2-nitro-3-methoxy-α-(oxo)benzenoacetic acid is 1.32280. |
| Q: What is the English name of 2-nitro-3-methoxy-α-(oxo)benzenoacetic acid? |
| A: The English name of 2-nitro-3-methoxy-α-(oxo)benzenoacetic acid is 2-nitro-3-methoxy-α-(oxo)benzenoacetic acid. |
| Q: What is the InChIKey of 2-nitro-3-methoxy-α-(oxo)benzenoacetic acid? |
| A: InChIKey of 2-nitro-3-methoxy-α-(oxo)benzenoacetic acid is DLKACZAQOCIILN-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 2-nitro-3-methoxy-α-(oxo)benzenoacetic acid? |
| A: Polar surface area (PSA) of 2-nitro-3-methoxy-α-(oxo)benzenoacetic acid is 109.42000. |
| Q: What English synonyms does 2-nitro-3-methoxy-α-(oxo)benzenoacetic acid have? |
| A: English synonyms of 2-nitro-3-methoxy-α-(oxo)benzenoacetic acid: (3-methoxy-2-nitro-phenyl)-pyruvic acid, (3-Methoxy-2-nitro-phenyl)-brenztraubensaeure. |
| Q: What is the Chinese name of 82204-33-9? |
| A: Chinese name of 82204-33-9 is 82204-33-9. |