7-Methoxy-1H-indole-2-carboxylic acid structure
|
Common Name | 7-Methoxy-1H-indole-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 24610-33-1 | Molecular Weight | 191.183 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 447.6±25.0 °C at 760 mmHg | |
| Molecular Formula | C10H9NO3 | Melting Point | 187-188ºC | |
| MSDS | N/A | Flash Point | 224.5±23.2 °C | |
| Name | 7-methoxy-1h-indole-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 447.6±25.0 °C at 760 mmHg |
| Melting Point | 187-188ºC |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.183 |
| Flash Point | 224.5±23.2 °C |
| Exact Mass | 191.058243 |
| PSA | 62.32000 |
| LogP | 2.22 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.677 |
| InChIKey | WYPRTJYUDCZXGF-UHFFFAOYSA-N |
| SMILES | COc1cccc2cc(C(=O)O)[nH]c12 |
| Hazard Codes | Xi: Irritant; |
|---|
|
~%
7-Methoxy-1H-in... CAS#:24610-33-1 |
| Literature: WO2004/22061 A1, ; Page/Page column 75-77 ; WO 2004/022061 A1 |
|
~94%
7-Methoxy-1H-in... CAS#:24610-33-1 |
| Literature: Coowar, Djalil; Bouissac, Julien; Hanbali, Mazen; Paschaki, Marie; Mohier, Eliane; Luu, Bang Journal of Medicinal Chemistry, 2004 , vol. 47, # 25 p. 6270 - 6282 |
|
~%
7-Methoxy-1H-in... CAS#:24610-33-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 47, # 25 p. 6270 - 6282 |
|
~%
7-Methoxy-1H-in... CAS#:24610-33-1 |
| Literature: Journal of the Chemical Society, , vol. 125, p. 313 |
| 7-Methoxy-1H-indole-2-carboxylic acid |
| 7-Methoxy-indol-2-carbonsaeure |
| 7-Methoxyindole-2-carboxylic acid |
| 1H-Indole-2-carboxylic acid, 7-methoxy- |