ethyl 5-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylate structure
|
Common Name | ethyl 5-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 823217-70-5 | Molecular Weight | 204.22500 | |
| Density | 1.232g/cm3 | Boiling Point | 369.4ºC at 760 mmHg | |
| Molecular Formula | C11H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.2ºC | |
| Name | ethyl 5-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.232g/cm3 |
|---|---|
| Boiling Point | 369.4ºC at 760 mmHg |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.22500 |
| Flash Point | 177.2ºC |
| Exact Mass | 204.09000 |
| PSA | 54.98000 |
| LogP | 2.04800 |
| Index of Refraction | 1.614 |
| InChIKey | TZFQDBAWCODGHL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc2cc(C)cnc2[nH]1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933990090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Pyrrolo[2,3-b]pyridine-2-carboxylic acid,5-methyl-,ethyl ester |
| 5-methyl-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid ethyl ester |