4-(Hydroxymethyl)-3-nitrobenzoic acid structure
|
Common Name | 4-(Hydroxymethyl)-3-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 82379-38-2 | Molecular Weight | 197.145 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 412.9±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H7NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.7±15.8 °C | |
| Name | 4-(hydroxymethyl)-3-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 412.9±40.0 °C at 760 mmHg |
| Molecular Formula | C8H7NO5 |
| Molecular Weight | 197.145 |
| Flash Point | 186.7±15.8 °C |
| Exact Mass | 197.032425 |
| PSA | 103.35000 |
| LogP | 0.64 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.643 |
| InChIKey | KUOYLJCVVIDGBZ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(CO)c([N+](=O)[O-])c1 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2918199090 |
|
~99%
4-(Hydroxymethy... CAS#:82379-38-2 |
| Literature: Eisenfuehr, Alexander; Arora, Paramjit S; Sengle, Gerhard; Takaoka, Leo R; Nowick, James S; Famulok, Michael Bioorganic and medicinal chemistry, 2003 , vol. 11, # 2 p. 235 - 249 |
|
~%
4-(Hydroxymethy... CAS#:82379-38-2 |
| Literature: Berteina, Sabine; De Mesmaeker, Alain Synlett, 1998 , # 11 p. 1227 - 1230 |
|
~%
4-(Hydroxymethy... CAS#:82379-38-2 |
| Literature: Zehavi, Uri; Sadeh, Shoshana; Herchman, Mina Carbohydrate Research, 1983 , vol. 124, p. 23 - 34 |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4-Hydroxymethyl-3-nitrobenzoic acid |
| 4-(Hydroxymethyl)-3-nitrobenzoic acid |