N-(4-oxo-5-phenylpentyl)acetamide
N-(4-oxo-5-phenylpentyl)acetamide structure
|
Common Name | N-(4-oxo-5-phenylpentyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 823821-72-3 | Molecular Weight | 219.28000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(4-oxo-5-phenylpentyl)acetamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H17NO2 |
|---|---|
| Molecular Weight | 219.28000 |
| Exact Mass | 219.12600 |
| PSA | 49.66000 |
| LogP | 2.55480 |
| InChIKey | BSDZHHBEWZWKAA-UHFFFAOYSA-N |
| SMILES | CC(=O)NCCCC(=O)Cc1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~88%
N-(4-oxo-5-phen... CAS#:823821-72-3 |
| Literature: Nenajdenko, Valentine G.; Zakurdaev, Eugene P.; Prusov, Eugene V.; Balenkova, Elizabeth S. Tetrahedron, 2004 , vol. 60, # 51 p. 11719 - 11724 |
|
~86%
N-(4-oxo-5-phen... CAS#:823821-72-3 |
| Literature: Zakurdaev, Eugene P.; Balenkova, Elizabeth S.; Nenajdenko, Valentine G. Mendeleev Communications, 2006 , # 4 p. 213 - 215 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Acetamide,N-(4-oxo-5-phenylpentyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N-(4-oxo-5-phenylpentyl)acetamide? |
| A: SMILES notation of N-(4-oxo-5-phenylpentyl)acetamide is CC(=O)NCCCC(=O)Cc1ccccc1. |
| Q: What is the molecular weight of N-(4-oxo-5-phenylpentyl)acetamide? |
| A: Molecular weight of N-(4-oxo-5-phenylpentyl)acetamide is 219.28000. |
| Q: What is the Chinese name of 823821-72-3? |
| A: Chinese name of 823821-72-3 is 823821-72-3. |
| Q: What is the molecular formula of N-(4-oxo-5-phenylpentyl)acetamide? |
| A: Molecular formula of N-(4-oxo-5-phenylpentyl)acetamide is C13H17NO2. |
| Q: What is the polar surface area (PSA) of N-(4-oxo-5-phenylpentyl)acetamide? |
| A: Polar surface area (PSA) of N-(4-oxo-5-phenylpentyl)acetamide is 49.66000. |
| Q: What is the LogP of N-(4-oxo-5-phenylpentyl)acetamide? |
| A: LogP of N-(4-oxo-5-phenylpentyl)acetamide is 2.55480. |
| Q: What is the InChIKey of N-(4-oxo-5-phenylpentyl)acetamide? |
| A: InChIKey of N-(4-oxo-5-phenylpentyl)acetamide is BSDZHHBEWZWKAA-UHFFFAOYSA-N. |
| Q: What English synonyms does N-(4-oxo-5-phenylpentyl)acetamide have? |
| A: English synonyms of N-(4-oxo-5-phenylpentyl)acetamide: Acetamide,N-(4-oxo-5-phenylpentyl). |
| Q: What is the English name of N-(4-oxo-5-phenylpentyl)acetamide? |
| A: The English name of N-(4-oxo-5-phenylpentyl)acetamide is N-(4-oxo-5-phenylpentyl)acetamide. |
| Q: What is the CAS number of N-(4-oxo-5-phenylpentyl)acetamide? |
| A: CAS number of N-(4-oxo-5-phenylpentyl)acetamide is 823821-72-3. |