4-[2-(2,4-dinitrophenyl)ethenyl]-N,N-diethylaniline structure
|
Common Name | 4-[2-(2,4-dinitrophenyl)ethenyl]-N,N-diethylaniline | ||
|---|---|---|---|---|
| CAS Number | 82410-01-3 | Molecular Weight | 341.36100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H19N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[2-(2,4-dinitrophenyl)ethenyl]-N,N-diethylaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H19N3O4 |
|---|---|
| Molecular Weight | 341.36100 |
| Exact Mass | 341.13800 |
| PSA | 94.88000 |
| LogP | 5.56600 |
| InChIKey | MCOCTGRJUNQZHV-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(C=Cc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
|
~%
4-[2-(2,4-dinit... CAS#:82410-01-3 |
| Literature: Dippy et al. Journal of the Society of Chemical Industry, London, 1937 , vol. 56, p. 369T |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Diaethyl-(2'.4'-dinitro-trans-stilbenyl-(4))-amin |
| Benzenamine,4-[2-(2,4-dinitrophenyl)ethenyl]-N,N-diethyl |
| diethyl-(2'.4'-dinitro-trans-stilbenyl-(4))-amine |