2-(4-Hydroxyphenyl)-1-phenyl-1-butanone structure
|
Common Name | 2-(4-Hydroxyphenyl)-1-phenyl-1-butanone | ||
|---|---|---|---|---|
| CAS Number | 82413-28-3 | Molecular Weight | 240.29700 | |
| Density | 1.123g/cm3 | Boiling Point | 391ºC at 760 mmHg | |
| Molecular Formula | C16H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167ºC | |
| Name | 2-(4-hydroxyphenyl)-1-phenylbutan-1-one |
|---|
| Density | 1.123g/cm3 |
|---|---|
| Boiling Point | 391ºC at 760 mmHg |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.29700 |
| Flash Point | 167ºC |
| Exact Mass | 240.11500 |
| PSA | 37.30000 |
| LogP | 3.76870 |
| Index of Refraction | 1.587 |
| InChIKey | FXJSXWBPLHSRGP-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)c1ccccc1)c1ccc(O)cc1 |
|
~79%
2-(4-Hydroxyphe... CAS#:82413-28-3 |
| Literature: Ruenitz, Peter C.; Bagley, Jerome R.; Mokler, Corwin M. Journal of Medicinal Chemistry, 1982 , vol. 25, # 9 p. 1056 - 1060 |
|
~%
2-(4-Hydroxyphe... CAS#:82413-28-3 |
| Literature: Journal of Medicinal Chemistry, , vol. 25, # 9 p. 1056 - 1060 |
|
~%
2-(4-Hydroxyphe... CAS#:82413-28-3 |
| Literature: Tetrahedron, , vol. 43, # 21 p. 5003 - 5018 |