Ethanone,2-(4-methoxyphenyl)-1-phenyl- structure
|
Common Name | Ethanone,2-(4-methoxyphenyl)-1-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 24845-40-7 | Molecular Weight | 226.270 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 362.0±17.0 °C at 760 mmHg | |
| Molecular Formula | C15H14O2 | Melting Point | 68 °C | |
| MSDS | N/A | Flash Point | 161.2±14.5 °C | |
| Name | 2-(4-methoxyphenyl)-1-phenylethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 362.0±17.0 °C at 760 mmHg |
| Melting Point | 68 °C |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.270 |
| Flash Point | 161.2±14.5 °C |
| Exact Mass | 226.099380 |
| PSA | 26.30000 |
| LogP | 3.09 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.570 |
| InChIKey | JABKESJVYSQBGF-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC(=O)c2ccccc2)cc1 |
| HS Code | 2914509090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| p-Methoxybenzyl phenyl ketone |
| 4'-Methoxydeoxybenzoin |
| 2-(p-Methoxyphenyl)acetophenone |
| 4-Methoxy-2-Phenylacetophenone |
| Ethanone, 2-(4-methoxyphenyl)-1-phenyl- |
| 2-(4-Methoxyphenyl)-1-phenylethanone |