magnesium,1,1,1,2,2,3,3,4,4-nonafluorobutane,bromide
magnesium,1,1,1,2,2,3,3,4,4-nonafluorobutane,bromide structure
|
Common Name | magnesium,1,1,1,2,2,3,3,4,4-nonafluorobutane,bromide | ||
|---|---|---|---|---|
| CAS Number | 82416-69-1 | Molecular Weight | 323.23700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4BrF9Mg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | magnesium,1,1,1,2,2,3,3,4,4-nonafluorobutane,bromide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C4BrF9Mg |
|---|---|
| Molecular Weight | 323.23700 |
| Exact Mass | 321.88900 |
| LogP | 0.25180 |
| InChIKey | HAPDLLGHSJCCGN-UHFFFAOYSA-M |
| SMILES | F[C-](F)C(F)(F)C(F)(F)C(F)(F)F.[Br-].[Mg+2] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
magnesium,1,1,1... CAS#:82416-69-1 |
| Literature: Nguyen, Thoai; Rubinstein, Michel; Wakselman, Claude Journal of Organic Chemistry, 1981 , vol. 46, # 9 p. 1938 - 1940 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 2 | |
CAS#:424-36-2
CAS#:22325-71-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (perfluorobutyl)magnesium bromide |
| Magnesium,bromo(nonafluorobutyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of magnesium,1,1,1,2,2,3,3,4,4-nonafluorobutane,bromide? |
| A: SMILES notation of magnesium,1,1,1,2,2,3,3,4,4-nonafluorobutane,bromide is F[C-](F)C(F)(F)C(F)(F)C(F)(F)F.[Br-].[Mg+2]. |
| Q: What is the English name of magnesium,1,1,1,2,2,3,3,4,4-nonafluorobutane,bromide? |
| A: The English name of magnesium,1,1,1,2,2,3,3,4,4-nonafluorobutane,bromide is magnesium,1,1,1,2,2,3,3,4,4-nonafluorobutane,bromide. |
| Q: What English synonyms does magnesium,1,1,1,2,2,3,3,4,4-nonafluorobutane,bromide have? |
| A: English synonyms of magnesium,1,1,1,2,2,3,3,4,4-nonafluorobutane,bromide: (perfluorobutyl)magnesium bromide, Magnesium,bromo(nonafluorobutyl). |
| Q: What are the upstream materials of magnesium,1,1,1,2,2,3,3,4,4-nonafluorobutane,bromide? |
| A: Related upstream materials(CAS) of magnesium,1,1,1,2,2,3,3,4,4-nonafluorobutane,bromide: 423-39-2;925-90-6. |
| Q: What is the CAS number of magnesium,1,1,1,2,2,3,3,4,4-nonafluorobutane,bromide? |
| A: CAS number of magnesium,1,1,1,2,2,3,3,4,4-nonafluorobutane,bromide is 82416-69-1. |
| Q: What is the LogP of magnesium,1,1,1,2,2,3,3,4,4-nonafluorobutane,bromide? |
| A: LogP of magnesium,1,1,1,2,2,3,3,4,4-nonafluorobutane,bromide is 0.25180. |
| Q: What is the Chinese name of 82416-69-1? |
| A: Chinese name of 82416-69-1 is 82416-69-1. |
| Q: What is the InChIKey of magnesium,1,1,1,2,2,3,3,4,4-nonafluorobutane,bromide? |
| A: InChIKey of magnesium,1,1,1,2,2,3,3,4,4-nonafluorobutane,bromide is HAPDLLGHSJCCGN-UHFFFAOYSA-M. |
| Q: What are the downstream products of magnesium,1,1,1,2,2,3,3,4,4-nonafluorobutane,bromide? |
| A: Related downstream products(CAS) of magnesium,1,1,1,2,2,3,3,4,4-nonafluorobutane,bromide: 424-36-2;22325-71-9. |
| Q: What is the molecular weight of magnesium,1,1,1,2,2,3,3,4,4-nonafluorobutane,bromide? |
| A: Molecular weight of magnesium,1,1,1,2,2,3,3,4,4-nonafluorobutane,bromide is 323.23700. |