Perfluorobutyl iodide structure
|
Common Name | Perfluorobutyl iodide | ||
|---|---|---|---|---|
| CAS Number | 423-39-2 | Molecular Weight | 345.93300 | |
| Density | 2.01 g/mL at 25 °C(lit.) | Boiling Point | 66-67 °C | |
| Molecular Formula | C4F9I | Melting Point | -88 °C | |
| MSDS | Chinese USA | Flash Point | None | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Perfluorobutyl iodide |
|---|---|
| Synonym | More Synonyms |
| Density | 2.01 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 66-67 °C |
| Melting Point | -88 °C |
| Molecular Formula | C4F9I |
| Molecular Weight | 345.93300 |
| Flash Point | None |
| Exact Mass | 345.89000 |
| LogP | 3.84710 |
| Vapour Pressure | 158mmHg at 25°C |
| Index of Refraction | n20/D 1.3285(lit.) |
| InChIKey | PGRFXXCKHGIFSV-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)I |
| Storage condition | 0-6°C |
| Stability | Stable. Incompatible with bases. |
| Water Solubility | immiscible |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| RTECS | EK5360000 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 29034700 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
The in vitro estrogenic activities of polyfluorinated iodine alkanes.
Environ. Health Perspect. 120(1) , 119-25, (2012) Polyfluorinated iodine alkanes (PFIs) are important intermediates in the synthesis of organic fluoride products. Recently, PFIs have been detected in fluoropolymers as residual raw materials, as well ... |
| MFCD00001062 |
| 1,1,1,2,2,3,3,4,4-nonafluoro-4-iodobutane |
| Nonafluorobutyl Iodide |
| Nonafluoro-1-iodobutane |
| Perfluorobutyl Iodide |
| EINECS 207-025-8 |