2,3-Dichlorobenzenesulfonyl chloride structure
|
Common Name | 2,3-Dichlorobenzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 82417-45-6 | Molecular Weight | 245.51100 | |
| Density | 1.636g/cm3 | Boiling Point | 140-142 °C (2 mmHg) | |
| Molecular Formula | C6H3Cl3O2S | Melting Point | 60-64 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 49 °F | |
| Symbol |
GHS02, GHS05 |
Signal Word | Danger | |
| Name | 2,3-Dichlorobenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.636g/cm3 |
|---|---|
| Boiling Point | 140-142 °C (2 mmHg) |
| Melting Point | 60-64 °C(lit.) |
| Molecular Formula | C6H3Cl3O2S |
| Molecular Weight | 245.51100 |
| Flash Point | 49 °F |
| Exact Mass | 243.89200 |
| PSA | 42.52000 |
| LogP | 4.00170 |
| Index of Refraction | 1.581 |
| InChIKey | PQODWTNHDKDHIW-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1cccc(Cl)c1Cl |
| Storage condition | 2-8°C |
| Symbol |
GHS02, GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H228-H314 |
| Precautionary Statements | P210-P280-P303 + P361 + P353-P304 + P340 + P310-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | F:Flammable;C:Corrosive; |
| Risk Phrases | R11;R34 |
| Safety Phrases | S16-S26-S36/37/39-S45 |
| RIDADR | UN 2925 4.1/PG 3 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2904909090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,3-dichloro-benzenesulfonyl chloride |
| BUTTPARK 9357-48 |
| 2,3-dichlorophenylsulfonyl chloride |
| 2,3-dichlorobenzenesulphonic acid chloride |
| dichlorobenzenesulfonyl chloride |
| 2,3-DICHLOROBENZENE-1-SULFONYL CHLORIDE |
| MFCD00051844 |
| 2,3-Dichlorobenzenesulphonyl chloride |