2-(2-hydroxypropan-2-yl)-2,3-dihydrobenzo[g][1]benzofuran-4,5-dione structure
|
Common Name | 2-(2-hydroxypropan-2-yl)-2,3-dihydrobenzo[g][1]benzofuran-4,5-dione | ||
|---|---|---|---|---|
| CAS Number | 82423-03-8 | Molecular Weight | 258.26900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-hydroxypropan-2-yl)-2,3-dihydrobenzo[g][1]benzofuran-4,5-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14O4 |
|---|---|
| Molecular Weight | 258.26900 |
| Exact Mass | 258.08900 |
| PSA | 63.60000 |
| LogP | 1.72290 |
| InChIKey | CSULKNDCWKWSBM-UHFFFAOYSA-N |
| SMILES | CC(C)(O)C1CC2=C(O1)c1ccccc1C(=O)C2=O |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
|
Name: Cytotoxicity against human promyelocytic leukemia HL60 cell line by MTT assay
Source: ChEMBL
Target: HL-60
External Id: CHEMBL856822
|
|
Name: Partition coefficient, log P of the compound
Source: ChEMBL
Target: N/A
External Id: CHEMBL856821
|
| 2-(1-hydroxy-1-methylethyl)-2,3-dihydronaphtho[1,2-b]furan-4,5-dione |
| Naphtho[1,2-b]furan-4,5-dione,2,3-dihydro-2-(1-hydroxy-1-methylethyl)-,(.+-.) |