Dehydro-alpha-lapachone structure
|
Common Name | Dehydro-alpha-lapachone | ||
|---|---|---|---|---|
| CAS Number | 15297-92-4 | Molecular Weight | 240.25 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 395.2±42.0 °C at 760 mmHg | |
| Molecular Formula | C15H12O3 | Melting Point | 145 °C | |
| MSDS | N/A | Flash Point | 177.0±27.9 °C | |
Use of Dehydro-alpha-lapachoneDehydro-α-lapachone can be isolated from the methanol extract of stems of Catalpa ovata G Don. Dehydro-α-lapachone inhibits mycelial growth of Botrytis cinerea with IC50 value 0.41 mg/L[1]. |
| Name | 2,2-dimethylbenzo[g]chromene-5,10-dione |
|---|---|
| Synonym | More Synonyms |
| Description | Dehydro-α-lapachone can be isolated from the methanol extract of stems of Catalpa ovata G Don. Dehydro-α-lapachone inhibits mycelial growth of Botrytis cinerea with IC50 value 0.41 mg/L[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 395.2±42.0 °C at 760 mmHg |
| Melting Point | 145 °C |
| Molecular Formula | C15H12O3 |
| Molecular Weight | 240.25 |
| Flash Point | 177.0±27.9 °C |
| Exact Mass | 240.078644 |
| PSA | 43.37000 |
| LogP | 3.14 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.620 |
| InChIKey | OWFHAMHRUCUSRM-UHFFFAOYSA-N |
| SMILES | CC1(C)C=CC2=C(O1)C(=O)c1ccccc1C2=O |
| Hazard Codes | T |
|---|---|
| HS Code | 2914399090 |
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| HS Code | 2914399090 |
|---|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Xyloidone |
| 2H-Naphtho[2,3-b]pyran-5,10-dione, 2,2-dimethyl- |
| DEHYDROPLAPACHONE |
| Dehydrolapachone |
| 2,2-Dimethyl-2H-benzo[g]chromene-5,10-dione |